49J
2-methoxy-4-[3-(morpholin-4-yl)[1,2]thiazolo[4,3-b]pyridin-6-yl]aniline
| Created: | 2015-02-17 |
| Last modified: | 2015-04-08 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 42 |
| Chiral Atom Count | 0 |
| Bond Count | 45 |
| Aromatic Bond Count | 16 |
Chemical Component Summary | |
|---|---|
| Name | 2-methoxy-4-[3-(morpholin-4-yl)[1,2]thiazolo[4,3-b]pyridin-6-yl]aniline |
| Systematic Name (OpenEye OEToolkits) | 2-methoxy-4-(3-morpholin-4-yl-[1,2]thiazolo[4,3-b]pyridin-6-yl)aniline |
| Formula | C17 H18 N4 O2 S |
| Molecular Weight | 342.415 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | n1cc(cc2nsc(c12)N3CCOCC3)c4ccc(N)c(OC)c4 |
| SMILES | CACTVS | 3.385 | COc1cc(ccc1N)c2cnc3c(snc3c2)N4CCOCC4 |
| SMILES | OpenEye OEToolkits | 1.9.2 | COc1cc(ccc1N)c2cc3c(c(sn3)N4CCOCC4)nc2 |
| Canonical SMILES | CACTVS | 3.385 | COc1cc(ccc1N)c2cnc3c(snc3c2)N4CCOCC4 |
| Canonical SMILES | OpenEye OEToolkits | 1.9.2 | COc1cc(ccc1N)c2cc3c(c(sn3)N4CCOCC4)nc2 |
| InChI | InChI | 1.03 | InChI=1S/C17H18N4O2S/c1-22-15-9-11(2-3-13(15)18)12-8-14-16(19-10-12)17(24-20-14)21-4-6-23-7-5-21/h2-3,8-10H,4-7,18H2,1H3 |
| InChIKey | InChI | 1.03 | AAUCXXCMBFZYRT-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3425867 |
| PubChem | 90467922 |
| ChEMBL | CHEMBL3425867 |














