6DF
[6-methyl-5-oxidanyl-4-[(~{E})-[(1~{R})-1-phenylethyl]iminomethyl]pyridin-3-yl]methyl dihydrogen phosphate
| Created: | 2016-03-18 |
| Last modified: | 2016-07-27 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 43 |
| Chiral Atom Count | 1 |
| Bond Count | 44 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | [6-methyl-5-oxidanyl-4-[(~{E})-[(1~{R})-1-phenylethyl]iminomethyl]pyridin-3-yl]methyl dihydrogen phosphate |
| Systematic Name (OpenEye OEToolkits) | [6-methyl-5-oxidanyl-4-[(~{E})-[(1~{R})-1-phenylethyl]iminomethyl]pyridin-3-yl]methyl dihydrogen phosphate |
| Formula | C16 H19 N2 O5 P |
| Molecular Weight | 350.306 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | C[CH](N=Cc1c(O)c(C)ncc1CO[P](O)(O)=O)c2ccccc2 |
| SMILES | OpenEye OEToolkits | 2.0.5 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(C)c2ccccc2)O |
| Canonical SMILES | CACTVS | 3.385 | C[C@@H](N=Cc1c(O)c(C)ncc1CO[P](O)(O)=O)c2ccccc2 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.5 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=N/[C@H](C)c2ccccc2)O |
| InChI | InChI | 1.03 | InChI=1S/C16H19N2O5P/c1-11(13-6-4-3-5-7-13)18-9-15-14(10-23-24(20,21)22)8-17-12(2)16(15)19/h3-9,11,19H,10H2,1-2H3,(H2,20,21,22)/b18-9+/t11-/m1/s1 |
| InChIKey | InChI | 1.03 | ZBWJIKYNMPWLJE-PBFYJAPKSA-N |














