7XF
(2~{S})-2-[[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]methylamino]-4-sulfanyl-butanoic acid
| Created: | 2017-02-03 |
| Last modified: | 2017-04-12 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 42 |
| Chiral Atom Count | 1 |
| Bond Count | 42 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | (2~{S})-2-[[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]methylamino]-4-sulfanyl-butanoic acid |
| Systematic Name (OpenEye OEToolkits) | (2~{S})-2-[[2-methyl-3-oxidanyl-5-(phosphonooxymethyl)pyridin-4-yl]methylamino]-4-sulfanyl-butanoic acid |
| Formula | C12 H19 N2 O7 P S |
| Molecular Weight | 366.327 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN[CH](CCS)C(O)=O)c1O |
| SMILES | OpenEye OEToolkits | 2.0.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CNC(CCS)C(=O)O)O |
| Canonical SMILES | CACTVS | 3.385 | Cc1ncc(CO[P](O)(O)=O)c(CN[C@@H](CCS)C(O)=O)c1O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | Cc1c(c(c(cn1)COP(=O)(O)O)CN[C@@H](CCS)C(=O)O)O |
| InChI | InChI | 1.03 | InChI=1S/C12H19N2O7PS/c1-7-11(15)9(5-14-10(2-3-23)12(16)17)8(4-13-7)6-21-22(18,19)20/h4,10,14-15,23H,2-3,5-6H2,1H3,(H,16,17)(H2,18,19,20)/t10-/m0/s1 |
| InChIKey | InChI | 1.03 | PXCMMZUTCUCUSM-JTQLQIEISA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 126476629 |














