A1H5B
8-nitro-2-[4-(trifluoromethyl)phenyl]-3H-quinazolin-4-one
| Created: | 2024-02-26 |
| Last modified: | 2025-03-12 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 32 |
| Chiral Atom Count | 0 |
| Bond Count | 34 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | 8-nitro-2-[4-(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
| Systematic Name (OpenEye OEToolkits) | 8-nitro-2-[4-(trifluoromethyl)phenyl]-3~{H}-quinazolin-4-one |
| Formula | C15 H8 F3 N3 O3 |
| Molecular Weight | 335.238 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | [O-][N+](=O)c1cccc2C(=O)NC(=Nc12)c3ccc(cc3)C(F)(F)F |
| SMILES | OpenEye OEToolkits | 2.0.7 | c1cc2c(c(c1)[N+](=O)[O-])N=C(NC2=O)c3ccc(cc3)C(F)(F)F |
| Canonical SMILES | CACTVS | 3.385 | [O-][N+](=O)c1cccc2C(=O)NC(=Nc12)c3ccc(cc3)C(F)(F)F |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | c1cc2c(c(c1)[N+](=O)[O-])N=C(NC2=O)c3ccc(cc3)C(F)(F)F |
| InChI | InChI | 1.06 | InChI=1S/C15H8F3N3O3/c16-15(17,18)9-6-4-8(5-7-9)13-19-12-10(14(22)20-13)2-1-3-11(12)21(23)24/h1-7H,(H,19,20,22) |
| InChIKey | InChI | 1.06 | DHHGYJRESXDLIW-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 172868971 |














