CDJ
5-amino-3-(4-chlorophenyl)isoquinolin-1(2H)-one
| Created: | 2014-08-07 |
| Last modified: | 2015-07-29 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 30 |
| Chiral Atom Count | 0 |
| Bond Count | 32 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | 5-amino-3-(4-chlorophenyl)isoquinolin-1(2H)-one |
| Systematic Name (OpenEye OEToolkits) | 5-azanyl-3-(4-chlorophenyl)-2H-isoquinolin-1-one |
| Formula | C15 H11 Cl N2 O |
| Molecular Weight | 270.714 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | Clc3ccc(C2=Cc1c(cccc1N)C(=O)N2)cc3 |
| SMILES | CACTVS | 3.385 | Nc1cccc2C(=O)NC(=Cc12)c3ccc(Cl)cc3 |
| SMILES | OpenEye OEToolkits | 1.7.6 | c1cc2c(c(c1)N)C=C(NC2=O)c3ccc(cc3)Cl |
| Canonical SMILES | CACTVS | 3.385 | Nc1cccc2C(=O)NC(=Cc12)c3ccc(Cl)cc3 |
| Canonical SMILES | OpenEye OEToolkits | 1.7.6 | c1cc2c(c(c1)N)C=C(NC2=O)c3ccc(cc3)Cl |
| InChI | InChI | 1.03 | InChI=1S/C15H11ClN2O/c16-10-6-4-9(5-7-10)14-8-12-11(15(19)18-14)2-1-3-13(12)17/h1-8H,17H2,(H,18,19) |
| InChIKey | InChI | 1.03 | WCRSKGPVBGETES-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2414046 |
| PubChem | 71769288 |
| ChEMBL | CHEMBL2414046 |














