F3N
3'-deoxy-3'-(L-phenylalanylamino)adenosine 5'-(dihydrogen phosphate)
| Created: | 2014-05-18 |
| Last modified: | 2014-08-20 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 58 |
| Chiral Atom Count | 5 |
| Bond Count | 61 |
| Aromatic Bond Count | 16 |
Chemical Component Summary | |
|---|---|
| Name | 3'-deoxy-3'-(L-phenylalanylamino)adenosine 5'-(dihydrogen phosphate) |
| Systematic Name (OpenEye OEToolkits) | [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3-[[(2S)-2-azanyl-3-phenyl-propanoyl]amino]-4-oxidanyl-oxolan-2-yl]methyl dihydrogen phosphate |
| Formula | C19 H24 N7 O7 P |
| Molecular Weight | 493.41 |
| Type | RNA LINKING |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=P(O)(O)OCC4OC(n2cnc1c(ncnc12)N)C(O)C4NC(=O)C(N)Cc3ccccc3 |
| SMILES | CACTVS | 3.385 | N[CH](Cc1ccccc1)C(=O)N[CH]2[CH](O)[CH](O[CH]2CO[P](O)(O)=O)n3cnc4c(N)ncnc34 |
| SMILES | OpenEye OEToolkits | 1.7.6 | c1ccc(cc1)CC(C(=O)NC2C(OC(C2O)n3cnc4c3ncnc4N)COP(=O)(O)O)N |
| Canonical SMILES | CACTVS | 3.385 | N[C@@H](Cc1ccccc1)C(=O)N[C@H]2[C@@H](O)[C@@H](O[C@@H]2CO[P](O)(O)=O)n3cnc4c(N)ncnc34 |
| Canonical SMILES | OpenEye OEToolkits | 1.7.6 | c1ccc(cc1)C[C@@H](C(=O)N[C@@H]2[C@H](O[C@H]([C@@H]2O)n3cnc4c3ncnc4N)COP(=O)(O)O)N |
| InChI | InChI | 1.03 | InChI=1S/C19H24N7O7P/c20-11(6-10-4-2-1-3-5-10)18(28)25-13-12(7-32-34(29,30)31)33-19(15(13)27)26-9-24-14-16(21)22-8-23-17(14)26/h1-5,8-9,11-13,15,19,27H,6-7,20H2,(H,25,28)(H2,21,22,23)(H2,29,30,31)/t11-,12+,13+,15+,19+/m0/s1 |
| InChIKey | InChI | 1.03 | FGNMGARNYLAFLT-YCOMJZELSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 137349309 |














