GAO
GUANINE ARABINOSE-5'-PHOSPHATE
| Created: | 2000-12-18 |
| Last modified: | 2011-06-04 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 38 |
| Chiral Atom Count | 4 |
| Bond Count | 40 |
| Aromatic Bond Count | 5 |
Chemical Component Summary | |
|---|---|
| Name | GUANINE ARABINOSE-5'-PHOSPHATE |
| Systematic Name (OpenEye OEToolkits) | [(2R,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methyl dihydrogen phosphate |
| Formula | C10 H14 N5 O8 P |
| Molecular Weight | 363.221 |
| Type | RNA LINKING |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 10.04 | O=C1c2ncn(c2N=C(N)N1)C3OC(C(O)C3O)COP(=O)(O)O |
| SMILES | CACTVS | 3.341 | NC1=Nc2n(cnc2C(=O)N1)[CH]3O[CH](CO[P](O)(O)=O)[CH](O)[CH]3O |
| SMILES | OpenEye OEToolkits | 1.5.0 | c1nc2c(n1C3C(C(C(O3)COP(=O)(O)O)O)O)N=C(NC2=O)N |
| Canonical SMILES | CACTVS | 3.341 | NC1=Nc2n(cnc2C(=O)N1)[C@@H]3O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@@H]3O |
| Canonical SMILES | OpenEye OEToolkits | 1.5.0 | c1nc2c(n1[C@H]3[C@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N=C(NC2=O)N |
| InChI | InChI | 1.03 | InChI=1S/C10H14N5O8P/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/t3-,5-,6+,9-/m1/s1 |
| InChIKey | InChI | 1.03 | RQFCJASXJCIDSX-FJFJXFQQSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 135603658, 13092276 |














