JBJ
(2R)-2-(5-fluoro-2-hydroxyphenyl)-2-{1-oxo-6-[4-(piperazin-1-yl)phenyl]-1,3-dihydro-2H-isoindol-2-yl}-N-(1,3-thiazol-2-yl)acetamide
| Created: | 2017-06-28 |
| Last modified: | 2019-06-05 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 65 |
| Chiral Atom Count | 1 |
| Bond Count | 70 |
| Aromatic Bond Count | 23 |
Chemical Component Summary | |
|---|---|
| Name | (2R)-2-(5-fluoro-2-hydroxyphenyl)-2-{1-oxo-6-[4-(piperazin-1-yl)phenyl]-1,3-dihydro-2H-isoindol-2-yl}-N-(1,3-thiazol-2-yl)acetamide |
| Systematic Name (OpenEye OEToolkits) | (2~{R})-2-(5-fluoranyl-2-oxidanyl-phenyl)-2-[3-oxidanylidene-5-(4-piperazin-1-ylphenyl)-1~{H}-isoindol-2-yl]-~{N}-(1,3-thiazol-2-yl)ethanamide |
| Formula | C29 H26 F N5 O3 S |
| Molecular Weight | 543.612 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | C(C(N4C(c1c(ccc(c1)c3ccc(N2CCNCC2)cc3)C4)=O)c5c(ccc(c5)F)O)(Nc6nccs6)=O |
| SMILES | CACTVS | 3.385 | Oc1ccc(F)cc1[CH](N2Cc3ccc(cc3C2=O)c4ccc(cc4)N5CCNCC5)C(=O)Nc6sccn6 |
| SMILES | OpenEye OEToolkits | 2.0.6 | c1cc(ccc1c2ccc3c(c2)C(=O)N(C3)C(c4cc(ccc4O)F)C(=O)Nc5nccs5)N6CCNCC6 |
| Canonical SMILES | CACTVS | 3.385 | Oc1ccc(F)cc1[C@@H](N2Cc3ccc(cc3C2=O)c4ccc(cc4)N5CCNCC5)C(=O)Nc6sccn6 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | c1cc(ccc1c2ccc3c(c2)C(=O)N(C3)[C@H](c4cc(ccc4O)F)C(=O)Nc5nccs5)N6CCNCC6 |
| InChI | InChI | 1.03 | InChI=1S/C29H26FN5O3S/c30-21-5-8-25(36)24(16-21)26(27(37)33-29-32-11-14-39-29)35-17-20-2-1-19(15-23(20)28(35)38)18-3-6-22(7-4-18)34-12-9-31-10-13-34/h1-8,11,14-16,26,31,36H,9-10,12-13,17H2,(H,32,33,37)/t26-/m1/s1 |
| InChIKey | InChI | 1.03 | VHQVOTINPRYDAO-AREMUKBSSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 124173751 |














