P85
N-[(4-fluorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide
| Created: | 2014-01-29 |
| Last modified: | 2014-09-05 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 56 |
| Chiral Atom Count | 1 |
| Bond Count | 59 |
| Aromatic Bond Count | 17 |
Chemical Component Summary | |
|---|---|
| Name | N-[(4-fluorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide |
| Systematic Name (OpenEye OEToolkits) | N-[(4-fluorophenyl)methyl]-1-[(1R)-1-naphthalen-1-ylethyl]piperidine-4-carboxamide |
| Formula | C25 H27 F N2 O |
| Molecular Weight | 390.493 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | Fc1ccc(cc1)CNC(=O)C4CCN(C(c3c2ccccc2ccc3)C)CC4 |
| SMILES | CACTVS | 3.385 | C[CH](N1CC[CH](CC1)C(=O)NCc2ccc(F)cc2)c3cccc4ccccc34 |
| SMILES | OpenEye OEToolkits | 1.9.2 | CC(c1cccc2c1cccc2)N3CCC(CC3)C(=O)NCc4ccc(cc4)F |
| Canonical SMILES | CACTVS | 3.385 | C[C@@H](N1CC[C@@H](CC1)C(=O)NCc2ccc(F)cc2)c3cccc4ccccc34 |
| Canonical SMILES | OpenEye OEToolkits | 1.9.2 | C[C@H](c1cccc2c1cccc2)N3CCC(CC3)C(=O)NCc4ccc(cc4)F |
| InChI | InChI | 1.03 | InChI=1S/C25H27FN2O/c1-18(23-8-4-6-20-5-2-3-7-24(20)23)28-15-13-21(14-16-28)25(29)27-17-19-9-11-22(26)12-10-19/h2-12,18,21H,13-17H2,1H3,(H,27,29)/t18-/m1/s1 |
| InChIKey | InChI | 1.03 | VTAUBQMDNJOEAK-GOSISDBHSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 73659185 |
| ChEMBL | CHEMBL3233814 |














