QL5
(2,5-dimethylphenyl) pyridine-4-carboxylate
| Created: | 2020-06-23 |
| Last modified: | 2020-07-29 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 30 |
| Chiral Atom Count | 0 |
| Bond Count | 31 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | (2,5-dimethylphenyl) pyridine-4-carboxylate |
| Systematic Name (OpenEye OEToolkits) | (2,5-dimethylphenyl) pyridine-4-carboxylate |
| Formula | C14 H13 N O2 |
| Molecular Weight | 227.259 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | Cc1ccc(C)c(OC(=O)c2ccncc2)c1 |
| SMILES | OpenEye OEToolkits | 2.0.7 | Cc1ccc(c(c1)OC(=O)c2ccncc2)C |
| Canonical SMILES | CACTVS | 3.385 | Cc1ccc(C)c(OC(=O)c2ccncc2)c1 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | Cc1ccc(c(c1)OC(=O)c2ccncc2)C |
| InChI | InChI | 1.03 | InChI=1S/C14H13NO2/c1-10-3-4-11(2)13(9-10)17-14(16)12-5-7-15-8-6-12/h3-9H,1-2H3 |
| InChIKey | InChI | 1.03 | MMVMRVVLUMIUAF-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 821673 |
| ChEMBL | CHEMBL1456302 |














