QQA
1-(6-((2-((6-amino-5-nitropyridin-2-yl)amino)ethyl)amino)-2-(2,4-dichlorophenyl)pyridin-3-yl)-4-methylpiperazin-2-one
| Created: | 2019-12-07 |
| Last modified: | 2022-06-22 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 60 |
| Chiral Atom Count | 0 |
| Bond Count | 63 |
| Aromatic Bond Count | 18 |
Chemical Component Summary | |
|---|---|
| Name | 1-(6-((2-((6-amino-5-nitropyridin-2-yl)amino)ethyl)amino)-2-(2,4-dichlorophenyl)pyridin-3-yl)-4-methylpiperazin-2-one |
| Systematic Name (OpenEye OEToolkits) | 1-[6-[2-[(6-azanyl-5-nitro-pyridin-2-yl)amino]ethylamino]-2-(2,4-dichlorophenyl)pyridin-3-yl]-4-methyl-piperazin-2-one |
| Formula | C23 H24 Cl2 N8 O3 |
| Molecular Weight | 531.394 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | CN1CC(=O)N(CC1)c1ccc(NCCNc2ccc([N+]([O-])=O)c(N)n2)nc1c1ccc(Cl)cc1Cl |
| SMILES | CACTVS | 3.385 | CN1CCN(C(=O)C1)c2ccc(NCCNc3ccc(c(N)n3)[N+]([O-])=O)nc2c4ccc(Cl)cc4Cl |
| SMILES | OpenEye OEToolkits | 2.0.7 | CN1CCN(C(=O)C1)c2ccc(nc2c3ccc(cc3Cl)Cl)NCCNc4ccc(c(n4)N)[N+](=O)[O-] |
| Canonical SMILES | CACTVS | 3.385 | CN1CCN(C(=O)C1)c2ccc(NCCNc3ccc(c(N)n3)[N+]([O-])=O)nc2c4ccc(Cl)cc4Cl |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CN1CCN(C(=O)C1)c2ccc(nc2c3ccc(cc3Cl)Cl)NCCNc4ccc(c(n4)N)[N+](=O)[O-] |
| InChI | InChI | 1.06 | InChI=1S/C23H24Cl2N8O3/c1-31-10-11-32(21(34)13-31)17-4-6-19(29-22(17)15-3-2-14(24)12-16(15)25)27-8-9-28-20-7-5-18(33(35)36)23(26)30-20/h2-7,12H,8-11,13H2,1H3,(H,27,29)(H3,26,28,30) |
| InChIKey | InChI | 1.06 | KLSRELDSEJWOAS-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 11548266 |
| ChEMBL | CHEMBL1242830 |














