RB0
D-ribitol
| Created: | 2012-05-17 |
| Last modified: | 2012-05-17 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 22 |
| Chiral Atom Count | 3 |
| Bond Count | 21 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | D-ribitol |
| Systematic Name (OpenEye OEToolkits) | (2S,4R)-pentane-1,2,3,4,5-pentol |
| Formula | C5 H12 O5 |
| Molecular Weight | 152.146 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | OC(CO)C(O)C(O)CO |
| SMILES | CACTVS | 3.370 | OC[CH](O)[CH](O)[CH](O)CO |
| SMILES | OpenEye OEToolkits | 1.7.6 | C(C(C(C(CO)O)O)O)O |
| Canonical SMILES | CACTVS | 3.370 | OC[C@H](O)[C@H](O)[C@H](O)CO |
| Canonical SMILES | OpenEye OEToolkits | 1.7.6 | C([C@H](C([C@H](CO)O)O)O)O |
| InChI | InChI | 1.03 | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| InChIKey | InChI | 1.03 | HEBKCHPVOIAQTA-ZXFHETKHSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB14704 |
|---|---|
| Name | Ribitol |
| Groups | experimental |
| Synonyms |
|
| Categories |
|
| CAS number | 488-81-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| CCDC/CSD | RIBTOL01, XYLTOL03, XYLTOL04, XYLTOL, XYLTOL01, RIBTOL, XYLTOL20, XYLTOL19, XYLTOL28, ARABOL01, INOYOC, XYLTOL21, XYLTOL22, XYLTOL23, XYLTOL27, XYLTOL18, XYLTOL16, XYLTOL25, XYLTOL09, XYLTOL26, XYLTOL08, XYLTOL07, XYLTOL29, XYLTOL24, XYLTOL14, XYLTOL17, XYLTOL05, XYLTOL06, XYLTOL10, XYLTOL11, ENIBAH, XYLTOL13, XYLTOL12, XYLTOL15, XYLTOL36, XYLTOL37, XYLTOL35, XYLTOL40, XYLTOL30, XYLTOL41, XYLTOL39, XYLTOL32, XYLTOL31, XYLTOL34, XYLTOL42, XYLTOL33 |
| COD | 2103961, 1566484, 1566486, 1566485, 1566488, 1566487, 1566489, 1566490, 1566491, 1566492, 1566493, 1566494, 1566495, 1566496, 1566498, 1566497, 1566499, 1566500, 2019352, 2108773, 2108772, 2108774, 2108775, 2108777, 2108776, 2108778, 2108779, 2108780, 2108781, 2108782, 2022044, 8000469, 2300678, 2311089 |














