TG
2-azanyl-9-[(2~{R},3~{R},4~{S})-3-oxidanyl-4-[oxidanyl-bis(oxidanylidene)-$l^{6}-phosphanyl]oxy-oxolan-2-yl]-1~{H}-purin-6-one
| Created: | 2018-10-23 |
| Last modified: | 2019-06-05 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 33 |
| Chiral Atom Count | 3 |
| Bond Count | 35 |
| Aromatic Bond Count | 5 |
Chemical Component Summary | |
|---|---|
| Name | 2-azanyl-9-[(2~{R},3~{R},4~{S})-3-oxidanyl-4-[oxidanyl-bis(oxidanylidene)-$l^{6}-phosphanyl]oxy-oxolan-2-yl]-1~{H}-purin-6-one |
| Systematic Name (OpenEye OEToolkits) | 2-azanyl-9-[(2~{R},3~{R},4~{S})-3-oxidanyl-4-[oxidanyl-bis(oxidanylidene)-$l^{6}-phosphanyl]oxy-oxolan-2-yl]-1~{H}-purin-6-one |
| Formula | C9 H11 N5 O7 P |
| Molecular Weight | 332.187 |
| Type | RNA LINKING |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | NC1=Nc2n(cnc2C(=O)N1)[CH]3OC[CH](O[P](O)(=O)=O)[CH]3O |
| SMILES | OpenEye OEToolkits | 2.0.6 | c1nc2c(n1C3C(C(CO3)OP(=O)(=O)O)O)N=C(NC2=O)N |
| Canonical SMILES | CACTVS | 3.385 | NC1=Nc2n(cnc2C(=O)N1)[C@@H]3OC[C@H](O[P](O)(=O)=O)[C@H]3O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | c1nc2c(n1[C@H]3[C@@H]([C@H](CO3)OP(=O)(=O)O)O)N=C(NC2=O)N |
| InChI | InChI | 1.03 | InChI=1S/C9H11N5O7P/c10-9-12-6-4(7(16)13-9)11-2-14(6)8-5(15)3(1-20-8)21-22(17,18)19/h2-3,5,8,15H,1H2,(H,17,18,19)(H3,10,12,13,16)/t3-,5+,8+/m0/s1 |
| InChIKey | InChI | 1.03 | RGZPMPBDCRFFGY-OTEWCHCRSA-N |














