WDD
1,3-dimethyl-8-{[2-(morpholin-4-yl)ethyl]amino}-3,7-dihydro-1H-purine-2,6-dione
| Created: | 2020-10-16 |
| Last modified: | 2021-03-10 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 42 |
| Chiral Atom Count | 0 |
| Bond Count | 44 |
| Aromatic Bond Count | 5 |
Chemical Component Summary | |
|---|---|
| Name | 1,3-dimethyl-8-{[2-(morpholin-4-yl)ethyl]amino}-3,7-dihydro-1H-purine-2,6-dione |
| Systematic Name (OpenEye OEToolkits) | 1,3-dimethyl-8-(2-morpholin-4-ylethylamino)-7~{H}-purine-2,6-dione |
| Formula | C13 H20 N6 O3 |
| Molecular Weight | 308.336 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | C(Nc1nc2c(n1)C(=O)N(C)C(N2C)=O)CN3CCOCC3 |
| SMILES | CACTVS | 3.385 | CN1C(=O)N(C)c2nc(NCCN3CCOCC3)[nH]c2C1=O |
| SMILES | OpenEye OEToolkits | 2.0.7 | CN1c2c([nH]c(n2)NCCN3CCOCC3)C(=O)N(C1=O)C |
| Canonical SMILES | CACTVS | 3.385 | CN1C(=O)N(C)c2nc(NCCN3CCOCC3)[nH]c2C1=O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CN1c2c([nH]c(n2)NCCN3CCOCC3)C(=O)N(C1=O)C |
| InChI | InChI | 1.03 | InChI=1S/C13H20N6O3/c1-17-10-9(11(20)18(2)13(17)21)15-12(16-10)14-3-4-19-5-7-22-8-6-19/h3-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | InChI | 1.03 | BAASUQZVWLHLKR-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 899583 |














