WIL
(1M)-7-methoxy-1-(3-methoxyphenyl)naphthalene-2-carboxylic acid
| Created: | 2023-05-12 |
| Last modified: | 2023-06-14 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 39 |
| Chiral Atom Count | 0 |
| Bond Count | 41 |
| Aromatic Bond Count | 17 |
Chemical Component Summary | |
|---|---|
| Name | (1M)-7-methoxy-1-(3-methoxyphenyl)naphthalene-2-carboxylic acid |
| Systematic Name (OpenEye OEToolkits) | 7-methoxy-1-(3-methoxyphenyl)naphthalene-2-carboxylic acid |
| Formula | C19 H16 O4 |
| Molecular Weight | 308.328 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | COc1cc(ccc1)c1c2cc(OC)ccc2ccc1C(=O)O |
| SMILES | CACTVS | 3.385 | COc1cccc(c1)c2c(ccc3ccc(OC)cc23)C(O)=O |
| SMILES | OpenEye OEToolkits | 2.0.7 | COc1cccc(c1)c2c(ccc3c2cc(cc3)OC)C(=O)O |
| Canonical SMILES | CACTVS | 3.385 | COc1cccc(c1)c2c(ccc3ccc(OC)cc23)C(O)=O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | COc1cccc(c1)c2c(ccc3c2cc(cc3)OC)C(=O)O |
| InChI | InChI | 1.06 | InChI=1S/C19H16O4/c1-22-14-5-3-4-13(10-14)18-16(19(20)21)9-7-12-6-8-15(23-2)11-17(12)18/h3-11H,1-2H3,(H,20,21) |
| InChIKey | InChI | 1.06 | JDSWYBFVGFQACV-UHFFFAOYSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 15097579 |














