Z6J
alpha-L-ribofuranose
| Created: | 2012-12-19 |
| Last modified: | 2020-07-17 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 20 |
| Chiral Atom Count | 4 |
| Bond Count | 20 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | alpha-L-ribofuranose |
| Synonyms | alpha-L-ribose; L-ribose; ribose |
| Systematic Name (OpenEye OEToolkits) | (2R,3S,4R,5S)-5-(hydroxymethyl)oxolane-2,3,4-triol |
| Formula | C5 H10 O5 |
| Molecular Weight | 150.13 |
| Type | L-SACCHARIDE, ALPHA LINKING |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | OC1C(OC(O)C1O)CO |
| SMILES | CACTVS | 3.370 | OC[CH]1O[CH](O)[CH](O)[CH]1O |
| SMILES | OpenEye OEToolkits | 1.7.6 | C(C1C(C(C(O1)O)O)O)O |
| Canonical SMILES | CACTVS | 3.370 | OC[C@@H]1O[C@@H](O)[C@@H](O)[C@H]1O |
| Canonical SMILES | OpenEye OEToolkits | 1.7.6 | C([C@H]1[C@@H]([C@@H]([C@@H](O1)O)O)O)O |
| InChI | InChI | 1.03 | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3-,4-,5+/m0/s1 |
| InChIKey | InChI | 1.03 | HMFHBZSHGGEWLO-NEEWWZBLSA-N |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 6971005 |
| ChEBI | CHEBI:47004 |














